About 3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine
3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine (PubChem CID 116854950) has the molecular formula C16H14BrN3
and a molecular weight of 328.21 g/mol. Its IUPAC name is 3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine |
| PubChem CID | 116854950 |
| Molecular Formula | C16H14BrN3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine |
| SMILES | Cc1nc2ccc(-c3ccc4c(c3)CCC4)nn2c1Br |
| InChI | InChI=1S/C16H14BrN3/c1-10-16(17)20-15(18-10)8-7-14(19-20)13-6-5-11-3-2-4-12(11)9-13/h5-9H,2-4H2,1H3 |
| InChIKey | ZYWFUGRESWDGIH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine?
The IUPAC name of 3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine (CID 116854950) is 3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine.
What is the SMILES notation for 3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine?
The canonical SMILES for 3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine is Cc1nc2ccc(-c3ccc4c(c3)CCC4)nn2c1Br.
What is the InChIKey of 3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine?
The InChIKey is ZYWFUGRESWDGIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrN3/c1-10-16(17)20-15(18-10)8-7-14(19-20)13-6-5-11-3-2-4-12(11)9-13/h5-9H,2-4H2,1H3.
What are the key properties of 3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine?
3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine has a molecular weight of 328.21 g/mol, XLogP of 3.96, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-(2,3-dihydro-1H-inden-5-yl)-2-methylimidazo[1,2-b]pyridazine is sourced from PubChem (CID 116854950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).