C13H18N4O — CID 82295331
4-(4-ethoxy-2,5-dimethylphenyl)imidazole-1,2-diamine (PubChem CID 82295331) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-(4-ethoxy-2,5-dimethylphenyl)imidazole-1,2-diamine.
| Compound Name | 4-(4-ethoxy-2,5-dimethylphenyl)imidazole-1,2-diamine |
|---|---|
| PubChem CID | 82295331 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 4-(4-ethoxy-2,5-dimethylphenyl)imidazole-1,2-diamine |
| SMILES | CCOc1cc(C)c(-c2cn(N)c(N)n2)cc1C |
| InChI | InChI=1S/C13H18N4O/c1-4-18-12-6-8(2)10(5-9(12)3)11-7-17(15)13(14)16-11/h5-7H,4,15H2,1-3H3,(H2,14,16) |
| InChIKey | NRDGDQOBYGXUQC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |