C13H16N4O — CID 82478515
5-(4-ethoxy-2,5-dimethylphenyl)-1,2,4-triazin-3-amine (PubChem CID 82478515) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 5-(4-ethoxy-2,5-dimethylphenyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(4-ethoxy-2,5-dimethylphenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 82478515 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 5-(4-ethoxy-2,5-dimethylphenyl)-1,2,4-triazin-3-amine |
| SMILES | CCOc1cc(C)c(-c2cnnc(N)n2)cc1C |
| InChI | InChI=1S/C13H16N4O/c1-4-18-12-6-8(2)10(5-9(12)3)11-7-15-17-13(14)16-11/h5-7H,4H2,1-3H3,(H2,14,16,17) |
| InChIKey | ORALIMVSBKXIJE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |