C16H25NO — CID 82296026
4-(4-ethoxy-2,5-dimethylphenyl)azepane (PubChem CID 82296026) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 4-(4-ethoxy-2,5-dimethylphenyl)azepane.
| Compound Name | 4-(4-ethoxy-2,5-dimethylphenyl)azepane |
|---|---|
| PubChem CID | 82296026 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 4-(4-ethoxy-2,5-dimethylphenyl)azepane |
| SMILES | CCOc1cc(C)c(C2CCCNCC2)cc1C |
| InChI | InChI=1S/C16H25NO/c1-4-18-16-11-12(2)15(10-13(16)3)14-6-5-8-17-9-7-14/h10-11,14,17H,4-9H2,1-3H3 |
| InChIKey | JGJNONIYECRRHH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |