C13H18BrN — CID 84808321
4-(4-bromo-2,5-dimethylphenyl)piperidine (PubChem CID 84808321) has the molecular formula C13H18BrN and a molecular weight of 268.20 g/mol. Its IUPAC name is 4-(4-bromo-2,5-dimethylphenyl)piperidine.
| Compound Name | 4-(4-bromo-2,5-dimethylphenyl)piperidine |
|---|---|
| PubChem CID | 84808321 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-(4-bromo-2,5-dimethylphenyl)piperidine |
| SMILES | Cc1cc(C2CCNCC2)c(C)cc1Br |
| InChI | InChI=1S/C13H18BrN/c1-9-8-13(14)10(2)7-12(9)11-3-5-15-6-4-11/h7-8,11,15H,3-6H2,1-2H3 |
| InChIKey | PFNFERFQDOAKJB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |