C15H23NO2 — CID 82297113
5-(4-methoxy-2,3-dimethylphenyl)-3,3-dimethylmorpholine (PubChem CID 82297113) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 5-(4-methoxy-2,3-dimethylphenyl)-3,3-dimethylmorpholine.
| Compound Name | 5-(4-methoxy-2,3-dimethylphenyl)-3,3-dimethylmorpholine |
|---|---|
| PubChem CID | 82297113 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 5-(4-methoxy-2,3-dimethylphenyl)-3,3-dimethylmorpholine |
| SMILES | COc1ccc(C2COCC(C)(C)N2)c(C)c1C |
| InChI | InChI=1S/C15H23NO2/c1-10-11(2)14(17-5)7-6-12(10)13-8-18-9-15(3,4)16-13/h6-7,13,16H,8-9H2,1-5H3 |
| InChIKey | GCBMEQOFLVVFJY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |