C13H19NO2S — CID 82298558
2-[(4-ethylphenyl)methyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 82298558) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is 2-[(4-ethylphenyl)methyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 2-[(4-ethylphenyl)methyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 82298558 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-[(4-ethylphenyl)methyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | CCc1ccc(CC2CNCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C13H19NO2S/c1-2-11-3-5-12(6-4-11)9-13-10-14-7-8-17(13,15)16/h3-6,13-14H,2,7-10H2,1H3 |
| InChIKey | SCBTWPQRXXXIBB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |