C16H23N3 — CID 82300147
3-[1-(1,4-diazepan-1-yl)propyl]-1H-indole (PubChem CID 82300147) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 3-[1-(1,4-diazepan-1-yl)propyl]-1H-indole.
| Compound Name | 3-[1-(1,4-diazepan-1-yl)propyl]-1H-indole |
|---|---|
| PubChem CID | 82300147 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 3-[1-(1,4-diazepan-1-yl)propyl]-1H-indole |
| SMILES | CCC(c1c[nH]c2ccccc12)N1CCCNCC1 |
| InChI | InChI=1S/C16H23N3/c1-2-16(19-10-5-8-17-9-11-19)14-12-18-15-7-4-3-6-13(14)15/h3-4,6-7,12,16-18H,2,5,8-11H2,1H3 |
| InChIKey | BOYYTPNMGAWHGZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |