C16H19FN2 — CID 82300622
N-[2-(2-aminoethyl)-4-fluorophenyl]-3,4-dimethylaniline (PubChem CID 82300622) has the molecular formula C16H19FN2 and a molecular weight of 258.34 g/mol. Its IUPAC name is N-[2-(2-aminoethyl)-4-fluorophenyl]-3,4-dimethylaniline.
| Compound Name | N-[2-(2-aminoethyl)-4-fluorophenyl]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 82300622 |
| Molecular Formula | C16H19FN2 |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-[2-(2-aminoethyl)-4-fluorophenyl]-3,4-dimethylaniline |
| SMILES | Cc1ccc(Nc2ccc(F)cc2CCN)cc1C |
| InChI | InChI=1S/C16H19FN2/c1-11-3-5-15(9-12(11)2)19-16-6-4-14(17)10-13(16)7-8-18/h3-6,9-10,19H,7-8,18H2,1-2H3 |
| InChIKey | WXCYRSDDHPOZHQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |