C14H14FN — CID 11020276
N-(4-fluorophenyl)-3,4-dimethylaniline (PubChem CID 11020276) has the molecular formula C14H14FN and a molecular weight of 215.27 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3,4-dimethylaniline.
| Compound Name | N-(4-fluorophenyl)-3,4-dimethylaniline |
|---|---|
| PubChem CID | 11020276 |
| Molecular Formula | C14H14FN |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N-(4-fluorophenyl)-3,4-dimethylaniline |
| SMILES | Cc1ccc(Nc2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C14H14FN/c1-10-3-6-14(9-11(10)2)16-13-7-4-12(15)5-8-13/h3-9,16H,1-2H3 |
| InChIKey | XLSLRMFCPHCMPV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |