C20H18IN — CID 10476038
N-[4-(4-iodophenyl)phenyl]-3,4-dimethylaniline (PubChem CID 10476038) has the molecular formula C20H18IN and a molecular weight of 399.28 g/mol. Its IUPAC name is N-[4-(4-iodophenyl)phenyl]-3,4-dimethylaniline.
| Compound Name | N-[4-(4-iodophenyl)phenyl]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 10476038 |
| Molecular Formula | C20H18IN |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-[4-(4-iodophenyl)phenyl]-3,4-dimethylaniline |
| SMILES | Cc1ccc(Nc2ccc(-c3ccc(I)cc3)cc2)cc1C |
| InChI | InChI=1S/C20H18IN/c1-14-3-10-20(13-15(14)2)22-19-11-6-17(7-12-19)16-4-8-18(21)9-5-16/h3-13,22H,1-2H3 |
| InChIKey | YRUARZNTTGBNOV-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|