C14H19N3O2 — CID 82302234
5-(aminomethyl)-5-(2,3,5,6-tetramethylphenyl)imidazolidine-2,4-dione (PubChem CID 82302234) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-(aminomethyl)-5-(2,3,5,6-tetramethylphenyl)imidazolidine-2,4-dione.
| Compound Name | 5-(aminomethyl)-5-(2,3,5,6-tetramethylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 82302234 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 5-(aminomethyl)-5-(2,3,5,6-tetramethylphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1cc(C)c(C)c(C2(CN)NC(=O)NC2=O)c1C |
| InChI | InChI=1S/C14H19N3O2/c1-7-5-8(2)10(4)11(9(7)3)14(6-15)12(18)16-13(19)17-14/h5H,6,15H2,1-4H3,(H2,16,17,18,19) |
| InChIKey | LQXAYWNZRKRDLF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|