C13H19N3O4 — CID 82309686
2-[2-carboxyethyl-[6-(dimethylamino)-3-pyridinyl]amino]propanoic acid (PubChem CID 82309686) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-[2-carboxyethyl-[6-(dimethylamino)-3-pyridinyl]amino]propanoic acid.
| Compound Name | 2-[2-carboxyethyl-[6-(dimethylamino)-3-pyridinyl]amino]propanoic acid |
|---|---|
| PubChem CID | 82309686 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-[2-carboxyethyl-[6-(dimethylamino)-3-pyridinyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(CCC(=O)O)c1ccc(N(C)C)nc1 |
| InChI | InChI=1S/C13H19N3O4/c1-9(13(19)20)16(7-6-12(17)18)10-4-5-11(14-8-10)15(2)3/h4-5,8-9H,6-7H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | MFLLHFVAGMOJQZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |