C14H19NO6S — CID 82310273
3-[2-carboxyethyl-(3-ethoxycarbonyl-5-methylthiophen-2-yl)amino]propanoic acid (PubChem CID 82310273) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is 3-[2-carboxyethyl-(3-ethoxycarbonyl-5-methylthiophen-2-yl)amino]propanoic acid.
| Compound Name | 3-[2-carboxyethyl-(3-ethoxycarbonyl-5-methylthiophen-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 82310273 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-[2-carboxyethyl-(3-ethoxycarbonyl-5-methylthiophen-2-yl)amino]propanoic acid |
| SMILES | CCOC(=O)c1cc(C)sc1N(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C14H19NO6S/c1-3-21-14(20)10-8-9(2)22-13(10)15(6-4-11(16)17)7-5-12(18)19/h8H,3-7H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | XBEPRCMBTZONBY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |