C15H21NO4S — CID 95507547
3-[(3-ethoxycarbonyl-4,5-dimethylthiophen-2-yl)-prop-2-enylamino]propanoic acid (PubChem CID 95507547) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 3-[(3-ethoxycarbonyl-4,5-dimethylthiophen-2-yl)-prop-2-enylamino]propanoic acid.
| Compound Name | 3-[(3-ethoxycarbonyl-4,5-dimethylthiophen-2-yl)-prop-2-enylamino]propanoic acid |
|---|---|
| PubChem CID | 95507547 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 3-[(3-ethoxycarbonyl-4,5-dimethylthiophen-2-yl)-prop-2-enylamino]propanoic acid |
| SMILES | C=CCN(CCC(=O)O)c1sc(C)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C15H21NO4S/c1-5-8-16(9-7-12(17)18)14-13(15(19)20-6-2)10(3)11(4)21-14/h5H,1,6-9H2,2-4H3,(H,17,18) |
| InChIKey | UGQJFNBFHVAXPQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|