C16H25NO4S — CID 82309915
3-[(3-methoxycarbonyl-4,5-dimethylthiophen-2-yl)-pentylamino]propanoic acid (PubChem CID 82309915) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is 3-[(3-methoxycarbonyl-4,5-dimethylthiophen-2-yl)-pentylamino]propanoic acid.
| Compound Name | 3-[(3-methoxycarbonyl-4,5-dimethylthiophen-2-yl)-pentylamino]propanoic acid |
|---|---|
| PubChem CID | 82309915 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 3-[(3-methoxycarbonyl-4,5-dimethylthiophen-2-yl)-pentylamino]propanoic acid |
| SMILES | CCCCCN(CCC(=O)O)c1sc(C)c(C)c1C(=O)OC |
| InChI | InChI=1S/C16H25NO4S/c1-5-6-7-9-17(10-8-13(18)19)15-14(16(20)21-4)11(2)12(3)22-15/h5-10H2,1-4H3,(H,18,19) |
| InChIKey | SETNFEXLATXFKP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|