C14H25N3O2S — CID 82310449
3-[nonyl(1,3,4-thiadiazol-2-yl)amino]propanoic acid (PubChem CID 82310449) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 3-[nonyl(1,3,4-thiadiazol-2-yl)amino]propanoic acid.
| Compound Name | 3-[nonyl(1,3,4-thiadiazol-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 82310449 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-[nonyl(1,3,4-thiadiazol-2-yl)amino]propanoic acid |
| SMILES | CCCCCCCCCN(CCC(=O)O)c1nncs1 |
| InChI | InChI=1S/C14H25N3O2S/c1-2-3-4-5-6-7-8-10-17(11-9-13(18)19)14-16-15-12-20-14/h12H,2-11H2,1H3,(H,18,19) |
| InChIKey | CNYNJFOTTMPMFC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|