C9H13N3O2S — CID 82310310
3-[2-methylprop-2-enyl(1,3,4-thiadiazol-2-yl)amino]propanoic acid (PubChem CID 82310310) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 3-[2-methylprop-2-enyl(1,3,4-thiadiazol-2-yl)amino]propanoic acid.
| Compound Name | 3-[2-methylprop-2-enyl(1,3,4-thiadiazol-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 82310310 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-[2-methylprop-2-enyl(1,3,4-thiadiazol-2-yl)amino]propanoic acid |
| SMILES | C=C(C)CN(CCC(=O)O)c1nncs1 |
| InChI | InChI=1S/C9H13N3O2S/c1-7(2)5-12(4-3-8(13)14)9-11-10-6-15-9/h6H,1,3-5H2,2H3,(H,13,14) |
| InChIKey | BAUSVFDOCNBBTE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|