C17H22N4 — CID 82311252
2-[2-(1-piperidin-1-ylpropyl)benzimidazol-1-yl]acetonitrile (PubChem CID 82311252) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-[2-(1-piperidin-1-ylpropyl)benzimidazol-1-yl]acetonitrile.
| Compound Name | 2-[2-(1-piperidin-1-ylpropyl)benzimidazol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 82311252 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-[2-(1-piperidin-1-ylpropyl)benzimidazol-1-yl]acetonitrile |
| SMILES | CCC(c1nc2ccccc2n1CC#N)N1CCCCC1 |
| InChI | InChI=1S/C17H22N4/c1-2-15(20-11-6-3-7-12-20)17-19-14-8-4-5-9-16(14)21(17)13-10-18/h4-5,8-9,15H,2-3,6-7,11-13H2,1H3 |
| InChIKey | BQINIJHJXQRPKH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |