C13H16ClNO4 — CID 82316984
3-[N-(carboxymethyl)-2-chloro-4,6-dimethylanilino]propanoic acid (PubChem CID 82316984) has the molecular formula C13H16ClNO4 and a molecular weight of 285.73 g/mol. Its IUPAC name is 3-[N-(carboxymethyl)-2-chloro-4,6-dimethylanilino]propanoic acid.
| Compound Name | 3-[N-(carboxymethyl)-2-chloro-4,6-dimethylanilino]propanoic acid |
|---|---|
| PubChem CID | 82316984 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 3-[N-(carboxymethyl)-2-chloro-4,6-dimethylanilino]propanoic acid |
| SMILES | Cc1cc(C)c(N(CCC(=O)O)CC(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C13H16ClNO4/c1-8-5-9(2)13(10(14)6-8)15(7-12(18)19)4-3-11(16)17/h5-6H,3-4,7H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | ABWVCHPCVDLWGG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |