C16H24ClNO2 — CID 82319096
3-[2-chloro-4,6-dimethyl-N-(3-methylbutyl)anilino]propanoic acid (PubChem CID 82319096) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is 3-[2-chloro-4,6-dimethyl-N-(3-methylbutyl)anilino]propanoic acid.
| Compound Name | 3-[2-chloro-4,6-dimethyl-N-(3-methylbutyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 82319096 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-[2-chloro-4,6-dimethyl-N-(3-methylbutyl)anilino]propanoic acid |
| SMILES | Cc1cc(C)c(N(CCC(=O)O)CCC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C16H24ClNO2/c1-11(2)5-7-18(8-6-15(19)20)16-13(4)9-12(3)10-14(16)17/h9-11H,5-8H2,1-4H3,(H,19,20) |
| InChIKey | MUULKTZAGADRSZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |