C13H16N2O4 — CID 82318414
3-[N-(cyanomethyl)-2,5-dimethoxyanilino]propanoic acid (PubChem CID 82318414) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-[N-(cyanomethyl)-2,5-dimethoxyanilino]propanoic acid.
| Compound Name | 3-[N-(cyanomethyl)-2,5-dimethoxyanilino]propanoic acid |
|---|---|
| PubChem CID | 82318414 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-[N-(cyanomethyl)-2,5-dimethoxyanilino]propanoic acid |
| SMILES | COc1ccc(OC)c(N(CC#N)CCC(=O)O)c1 |
| InChI | InChI=1S/C13H16N2O4/c1-18-10-3-4-12(19-2)11(9-10)15(8-6-14)7-5-13(16)17/h3-4,9H,5,7-8H2,1-2H3,(H,16,17) |
| InChIKey | KKTAXPWRXAUWPY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|