3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid

C16H23NO5 — CID 95533535

IUPAC3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid
SMILESCCCCC(=O)N(CCC(=O)O)c1cc(OC)ccc1OC
InChIInChI=1S/C16H23NO5/c1-4-5-6-15(18)17(10-9-16(19)20)13-11-12(21-2)7-8-14(13)22-3/h7-8,11H,4-6,9-10H2,1-3H3,(H,19,20)
InChIKeyRNHGPNQGTOMKNY-UHFFFAOYSA-N
MW309.36 g/mol
LogP2.70
Rot. Bonds9

About 3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid

3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid (PubChem CID 95533535) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid.

Molecular Properties

Compound Name3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid
PubChem CID95533535
Molecular FormulaC16H23NO5
Molecular Weight309.36 g/mol
Exact Mass309.16
IUPAC Name3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid
SMILESCCCCC(=O)N(CCC(=O)O)c1cc(OC)ccc1OC
InChIInChI=1S/C16H23NO5/c1-4-5-6-15(18)17(10-9-16(19)20)13-11-12(21-2)7-8-14(13)22-3/h7-8,11H,4-6,9-10H2,1-3H3,(H,19,20)
InChIKeyRNHGPNQGTOMKNY-UHFFFAOYSA-N
XLogP2.70
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.36
LogP ≤ 52.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid?
The IUPAC name of 3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid (CID 95533535) is 3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid.
What is the SMILES notation for 3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid?
The canonical SMILES for 3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid is CCCCC(=O)N(CCC(=O)O)c1cc(OC)ccc1OC.
What is the InChIKey of 3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid?
The InChIKey is RNHGPNQGTOMKNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO5/c1-4-5-6-15(18)17(10-9-16(19)20)13-11-12(21-2)7-8-14(13)22-3/h7-8,11H,4-6,9-10H2,1-3H3,(H,19,20).
What are the key properties of 3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid?
3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid has a molecular weight of 309.36 g/mol, XLogP of 2.70, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethoxy-N-pentanoylanilino)propanoic acid is sourced from PubChem (CID 95533535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).