C11H10F2N2O2 — CID 82318455
3-[N-(cyanomethyl)-3,4-difluoroanilino]propanoic acid (PubChem CID 82318455) has the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. Its IUPAC name is 3-[N-(cyanomethyl)-3,4-difluoroanilino]propanoic acid.
| Compound Name | 3-[N-(cyanomethyl)-3,4-difluoroanilino]propanoic acid |
|---|---|
| PubChem CID | 82318455 |
| Molecular Formula | C11H10F2N2O2 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 3-[N-(cyanomethyl)-3,4-difluoroanilino]propanoic acid |
| SMILES | N#CCN(CCC(=O)O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H10F2N2O2/c12-9-2-1-8(7-10(9)13)15(6-4-14)5-3-11(16)17/h1-2,7H,3,5-6H2,(H,16,17) |
| InChIKey | LNCAJORUEDHQAV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|