3-(3-fluoro-N-phenacylanilino)propanoic acid

C17H16FNO3 — CID 82319710

IUPAC3-(3-fluoro-N-phenacylanilino)propanoic acid
SMILESO=C(O)CCN(CC(=O)c1ccccc1)c1cccc(F)c1
InChIInChI=1S/C17H16FNO3/c18-14-7-4-8-15(11-14)19(10-9-17(21)22)12-16(20)13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H,21,22)
InChIKeyNJZHGAIYUUPVMT-UHFFFAOYSA-N
MW301.32 g/mol
LogP2.99
Rot. Bonds7

About 3-(3-fluoro-N-phenacylanilino)propanoic acid

3-(3-fluoro-N-phenacylanilino)propanoic acid (PubChem CID 82319710) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is 3-(3-fluoro-N-phenacylanilino)propanoic acid.

Molecular Properties

Compound Name3-(3-fluoro-N-phenacylanilino)propanoic acid
PubChem CID82319710
Molecular FormulaC17H16FNO3
Molecular Weight301.32 g/mol
Exact Mass301.11
IUPAC Name3-(3-fluoro-N-phenacylanilino)propanoic acid
SMILESO=C(O)CCN(CC(=O)c1ccccc1)c1cccc(F)c1
InChIInChI=1S/C17H16FNO3/c18-14-7-4-8-15(11-14)19(10-9-17(21)22)12-16(20)13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H,21,22)
InChIKeyNJZHGAIYUUPVMT-UHFFFAOYSA-N
XLogP2.99
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.32
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(3-fluoro-N-phenacylanilino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-[3-fluoro-N-(2-methylpropyl)anilino]propanoic acid
CID 82319254
2-(N-ethylanilino)-1-(3-fluorophenyl)ethanone
CID 43227492
3-(3-fluoro-N-(3-fluorobenzoyl)anilino)propanoic acid
CID 82321619
3-[3-fluoro-N-(3-methylbutyl)anilino]propanoic acid
CID 82319115
3-[3-fluoro-N-[(2-methoxycarbonylphenyl)methyl]anilino]propanoic acid
CID 43831189
3-[N-(2,2-dimethylpropanoyl)-3-fluoroanilino]propanoic acid
CID 28764336
2-[N-(2-carboxyethyl)-3-fluoroanilino]propanoic acid
CID 82317163
3-[3-chloro-N-[(3-fluorophenyl)methyl]anilino]propanoic acid
CID 95532653
3-[N-[(5-fluoro-2-methylphenyl)methyl]anilino]propanoic acid
CID 105372393
3-[N-(2-bromoprop-2-enyl)anilino]propanoic acid
CID 60873032
3-[N-[(3-fluorophenyl)methyl]-3-methoxyanilino]propanoic acid
CID 82320063
1-(2-bromophenyl)-3-(N-ethyl-3-fluoroanilino)propan-1-one
CID 63482091

Frequently Asked Questions

What is the IUPAC name of 3-(3-fluoro-N-phenacylanilino)propanoic acid?
The IUPAC name of 3-(3-fluoro-N-phenacylanilino)propanoic acid (CID 82319710) is 3-(3-fluoro-N-phenacylanilino)propanoic acid.
What is the SMILES notation for 3-(3-fluoro-N-phenacylanilino)propanoic acid?
The canonical SMILES for 3-(3-fluoro-N-phenacylanilino)propanoic acid is O=C(O)CCN(CC(=O)c1ccccc1)c1cccc(F)c1.
What is the InChIKey of 3-(3-fluoro-N-phenacylanilino)propanoic acid?
The InChIKey is NJZHGAIYUUPVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FNO3/c18-14-7-4-8-15(11-14)19(10-9-17(21)22)12-16(20)13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H,21,22).
What are the key properties of 3-(3-fluoro-N-phenacylanilino)propanoic acid?
3-(3-fluoro-N-phenacylanilino)propanoic acid has a molecular weight of 301.32 g/mol, XLogP of 2.99, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-fluoro-N-phenacylanilino)propanoic acid is sourced from PubChem (CID 82319710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).