C13H18Cl2N2O2 — CID 82319825
3-[2,5-dichloro-N-[2-(dimethylamino)ethyl]anilino]propanoic acid (PubChem CID 82319825) has the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. Its IUPAC name is 3-[2,5-dichloro-N-[2-(dimethylamino)ethyl]anilino]propanoic acid.
| Compound Name | 3-[2,5-dichloro-N-[2-(dimethylamino)ethyl]anilino]propanoic acid |
|---|---|
| PubChem CID | 82319825 |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-[2,5-dichloro-N-[2-(dimethylamino)ethyl]anilino]propanoic acid |
| SMILES | CN(C)CCN(CCC(=O)O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H18Cl2N2O2/c1-16(2)7-8-17(6-5-13(18)19)12-9-10(14)3-4-11(12)15/h3-4,9H,5-8H2,1-2H3,(H,18,19) |
| InChIKey | CIUUFUCLAYGJRZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |