2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid

C10H9Cl2NO3S — CID 87892233

IUPAC2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid
SMILESCN(C(=O)SCC(=O)O)c1cc(Cl)ccc1Cl
InChIInChI=1S/C10H9Cl2NO3S/c1-13(10(16)17-5-9(14)15)8-4-6(11)2-3-7(8)12/h2-4H,5H2,1H3,(H,14,15)
InChIKeyNCFHWZADMJAKDQ-UHFFFAOYSA-N
MW294.16 g/mol
LogP3.37
Rot. Bonds3

About 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid

2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid (PubChem CID 87892233) has the molecular formula C10H9Cl2NO3S and a molecular weight of 294.16 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid.

Molecular Properties

Compound Name2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid
PubChem CID87892233
Molecular FormulaC10H9Cl2NO3S
Molecular Weight294.16 g/mol
Exact Mass292.97
IUPAC Name2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid
SMILESCN(C(=O)SCC(=O)O)c1cc(Cl)ccc1Cl
InChIInChI=1S/C10H9Cl2NO3S/c1-13(10(16)17-5-9(14)15)8-4-6(11)2-3-7(8)12/h2-4H,5H2,1H3,(H,14,15)
InChIKeyNCFHWZADMJAKDQ-UHFFFAOYSA-N
XLogP3.37
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.16
LogP ≤ 53.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid?
The IUPAC name of 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid (CID 87892233) is 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid.
What is the SMILES notation for 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid?
The canonical SMILES for 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid is CN(C(=O)SCC(=O)O)c1cc(Cl)ccc1Cl.
What is the InChIKey of 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid?
The InChIKey is NCFHWZADMJAKDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2NO3S/c1-13(10(16)17-5-9(14)15)8-4-6(11)2-3-7(8)12/h2-4H,5H2,1H3,(H,14,15).
What are the key properties of 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid?
2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid has a molecular weight of 294.16 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid is sourced from PubChem (CID 87892233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).