C10H9Cl2NO3S — CID 87892233
2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid (PubChem CID 87892233) has the molecular formula C10H9Cl2NO3S and a molecular weight of 294.16 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid.
| Compound Name | 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 87892233 |
| Molecular Formula | C10H9Cl2NO3S |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)-methylcarbamoyl]sulfanylacetic acid |
| SMILES | CN(C(=O)SCC(=O)O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H9Cl2NO3S/c1-13(10(16)17-5-9(14)15)8-4-6(11)2-3-7(8)12/h2-4H,5H2,1H3,(H,14,15) |
| InChIKey | NCFHWZADMJAKDQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|