C10H10Cl2N2O2 — CID 176888578
(2Z)-2-[(2,5-dichlorophenyl)-ethylhydrazinylidene]acetic acid (PubChem CID 176888578) has the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.11 g/mol. Its IUPAC name is (2Z)-2-[(2,5-dichlorophenyl)-ethylhydrazinylidene]acetic acid.
| Compound Name | (2Z)-2-[(2,5-dichlorophenyl)-ethylhydrazinylidene]acetic acid |
|---|---|
| PubChem CID | 176888578 |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | (2Z)-2-[(2,5-dichlorophenyl)-ethylhydrazinylidene]acetic acid |
| SMILES | CCN(/N=C\C(=O)O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H10Cl2N2O2/c1-2-14(13-6-10(15)16)9-5-7(11)3-4-8(9)12/h3-6H,2H2,1H3,(H,15,16)/b13-6- |
| InChIKey | ATSSTIDUMNKRIL-MLPAPPSSSA-N |
| XLogP | 2.89 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|