C14H23N3O2 — CID 82319922
3-[2-(dimethylamino)ethyl-(3-methyl-2-pyridinyl)amino]-2-methylpropanoic acid (PubChem CID 82319922) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethyl-(3-methyl-2-pyridinyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[2-(dimethylamino)ethyl-(3-methyl-2-pyridinyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82319922 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 3-[2-(dimethylamino)ethyl-(3-methyl-2-pyridinyl)amino]-2-methylpropanoic acid |
| SMILES | Cc1cccnc1N(CCN(C)C)CC(C)C(=O)O |
| InChI | InChI=1S/C14H23N3O2/c1-11-6-5-7-15-13(11)17(9-8-16(3)4)10-12(2)14(18)19/h5-7,12H,8-10H2,1-4H3,(H,18,19) |
| InChIKey | YPXAKHHDSKRIQB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |