C14H17NO5 — CID 82324587
2-[2-carboxyethyl-(2-methylbenzoyl)amino]propanoic acid (PubChem CID 82324587) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 2-[2-carboxyethyl-(2-methylbenzoyl)amino]propanoic acid.
| Compound Name | 2-[2-carboxyethyl-(2-methylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 82324587 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-[2-carboxyethyl-(2-methylbenzoyl)amino]propanoic acid |
| SMILES | Cc1ccccc1C(=O)N(CCC(=O)O)C(C)C(=O)O |
| InChI | InChI=1S/C14H17NO5/c1-9-5-3-4-6-11(9)13(18)15(8-7-12(16)17)10(2)14(19)20/h3-6,10H,7-8H2,1-2H3,(H,16,17)(H,19,20) |
| InChIKey | UVYPWTQCGNTABV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |