C13H14FNO5 — CID 82324857
2-[2-carboxyethyl-(4-fluorobenzoyl)amino]propanoic acid (PubChem CID 82324857) has the molecular formula C13H14FNO5 and a molecular weight of 283.25 g/mol. Its IUPAC name is 2-[2-carboxyethyl-(4-fluorobenzoyl)amino]propanoic acid.
| Compound Name | 2-[2-carboxyethyl-(4-fluorobenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 82324857 |
| Molecular Formula | C13H14FNO5 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-[2-carboxyethyl-(4-fluorobenzoyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(CCC(=O)O)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H14FNO5/c1-8(13(19)20)15(7-6-11(16)17)12(18)9-2-4-10(14)5-3-9/h2-5,8H,6-7H2,1H3,(H,16,17)(H,19,20) |
| InChIKey | SPXXUZCGCANEGX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |