C8H12Cl3NO4 — CID 82325919
3-[3-hydroxypropyl-(2,2,2-trichloroacetyl)amino]propanoic acid (PubChem CID 82325919) has the molecular formula C8H12Cl3NO4 and a molecular weight of 292.55 g/mol. Its IUPAC name is 3-[3-hydroxypropyl-(2,2,2-trichloroacetyl)amino]propanoic acid.
| Compound Name | 3-[3-hydroxypropyl-(2,2,2-trichloroacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 82325919 |
| Molecular Formula | C8H12Cl3NO4 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | 3-[3-hydroxypropyl-(2,2,2-trichloroacetyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(CCCO)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H12Cl3NO4/c9-8(10,11)7(16)12(3-1-5-13)4-2-6(14)15/h13H,1-5H2,(H,14,15) |
| InChIKey | LAUQNMPWZYVAPG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|