C7H10Cl3NO4 — CID 82325918
3-[2-hydroxyethyl-(2,2,2-trichloroacetyl)amino]propanoic acid (PubChem CID 82325918) has the molecular formula C7H10Cl3NO4 and a molecular weight of 278.52 g/mol. Its IUPAC name is 3-[2-hydroxyethyl-(2,2,2-trichloroacetyl)amino]propanoic acid.
| Compound Name | 3-[2-hydroxyethyl-(2,2,2-trichloroacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 82325918 |
| Molecular Formula | C7H10Cl3NO4 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | 3-[2-hydroxyethyl-(2,2,2-trichloroacetyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(CCO)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H10Cl3NO4/c8-7(9,10)6(15)11(3-4-12)2-1-5(13)14/h12H,1-4H2,(H,13,14) |
| InChIKey | LTUUORWMWKQACF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|