About 3-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid
3-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid (PubChem CID 82325823) has the molecular formula C7H8F3NO5
and a molecular weight of 243.14 g/mol. Its IUPAC name is 3-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid.
Analyze 3-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid?
The IUPAC name of 3-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid (CID 82325823) is 3-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid.
What is the SMILES notation for 3-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid?
The canonical SMILES for 3-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid is O=C(O)CCN(CC(=O)O)C(=O)C(F)(F)F.
What is the InChIKey of 3-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid?
The InChIKey is UCNUETLMXPCHIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3NO5/c8-7(9,10)6(16)11(3-5(14)15)2-1-4(12)13/h1-3H2,(H,12,13)(H,14,15).
What are the key properties of 3-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid?
3-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid has a molecular weight of 243.14 g/mol, XLogP of -0.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[carboxymethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid is sourced from PubChem (CID 82325823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).