C11H21F3N3O4P — CID 54568245
2-[bis(propan-2-ylamino)phosphorylmethyl-(2,2,2-trifluoroacetyl)amino]acetic acid (PubChem CID 54568245) has the molecular formula C11H21F3N3O4P and a molecular weight of 347.27 g/mol. Its IUPAC name is 2-[bis(propan-2-ylamino)phosphorylmethyl-(2,2,2-trifluoroacetyl)amino]acetic acid.
| Compound Name | 2-[bis(propan-2-ylamino)phosphorylmethyl-(2,2,2-trifluoroacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 54568245 |
| Molecular Formula | C11H21F3N3O4P |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-[bis(propan-2-ylamino)phosphorylmethyl-(2,2,2-trifluoroacetyl)amino]acetic acid |
| SMILES | CC(C)NP(=O)(CN(CC(=O)O)C(=O)C(F)(F)F)NC(C)C |
| InChI | InChI=1S/C11H21F3N3O4P/c1-7(2)15-22(21,16-8(3)4)6-17(5-9(18)19)10(20)11(12,13)14/h7-8H,5-6H2,1-4H3,(H,18,19)(H2,15,16,21) |
| InChIKey | ZVJNNWDCXCYTKV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|