C13H18F3NO3 — CID 82325868
3-[2-(cyclohexen-1-yl)ethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid (PubChem CID 82325868) has the molecular formula C13H18F3NO3 and a molecular weight of 293.28 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 82325868 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyl-(2,2,2-trifluoroacetyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(CCC1=CCCCC1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C13H18F3NO3/c14-13(15,16)12(20)17(9-7-11(18)19)8-6-10-4-2-1-3-5-10/h4H,1-3,5-9H2,(H,18,19) |
| InChIKey | MOIJHHZHAAGYAC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|