C14H23NO5 — CID 82326245
2-[2-carboxypropyl(3-methylbut-2-enoyl)amino]-3-methylbutanoic acid (PubChem CID 82326245) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[2-carboxypropyl(3-methylbut-2-enoyl)amino]-3-methylbutanoic acid.
| Compound Name | 2-[2-carboxypropyl(3-methylbut-2-enoyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 82326245 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-[2-carboxypropyl(3-methylbut-2-enoyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)=CC(=O)N(CC(C)C(=O)O)C(C(=O)O)C(C)C |
| InChI | InChI=1S/C14H23NO5/c1-8(2)6-11(16)15(7-10(5)13(17)18)12(9(3)4)14(19)20/h6,9-10,12H,7H2,1-5H3,(H,17,18)(H,19,20) |
| InChIKey | MYUMHRVTGKKZGF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|