C15H23N3O3 — CID 82326260
3-[3-imidazol-1-ylpropyl(3-methylbut-2-enoyl)amino]-2-methylpropanoic acid (PubChem CID 82326260) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-[3-imidazol-1-ylpropyl(3-methylbut-2-enoyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[3-imidazol-1-ylpropyl(3-methylbut-2-enoyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82326260 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3-[3-imidazol-1-ylpropyl(3-methylbut-2-enoyl)amino]-2-methylpropanoic acid |
| SMILES | CC(C)=CC(=O)N(CCCn1ccnc1)CC(C)C(=O)O |
| InChI | InChI=1S/C15H23N3O3/c1-12(2)9-14(19)18(10-13(3)15(20)21)7-4-6-17-8-5-16-11-17/h5,8-9,11,13H,4,6-7,10H2,1-3H3,(H,20,21) |
| InChIKey | USFFVHVDHCYTPX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|