C12H16N2O2 — CID 82327980
3-[prop-2-enyl(pyridin-4-ylmethyl)amino]propanoic acid (PubChem CID 82327980) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-[prop-2-enyl(pyridin-4-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[prop-2-enyl(pyridin-4-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 82327980 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 3-[prop-2-enyl(pyridin-4-ylmethyl)amino]propanoic acid |
| SMILES | C=CCN(CCC(=O)O)Cc1ccncc1 |
| InChI | InChI=1S/C12H16N2O2/c1-2-8-14(9-5-12(15)16)10-11-3-6-13-7-4-11/h2-4,6-7H,1,5,8-10H2,(H,15,16) |
| InChIKey | SZGCBLNLYGNRND-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|