C10H19NO4 — CID 82328730
2-[2-carboxyethyl(methyl)amino]hexanoic acid (PubChem CID 82328730) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-[2-carboxyethyl(methyl)amino]hexanoic acid.
| Compound Name | 2-[2-carboxyethyl(methyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 82328730 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-[2-carboxyethyl(methyl)amino]hexanoic acid |
| SMILES | CCCCC(C(=O)O)N(C)CCC(=O)O |
| InChI | InChI=1S/C10H19NO4/c1-3-4-5-8(10(14)15)11(2)7-6-9(12)13/h8H,3-7H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | RDUVONFURHCWBH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |