C26H40N2O16 — CID 169227887
2-[2-[bis(1,4-dicarboxybutyl)amino]ethyl-(1,4-dicarboxybutyl)amino]hexanedioic acid (PubChem CID 169227887) has the molecular formula C26H40N2O16 and a molecular weight of 636.60 g/mol. Its IUPAC name is 2-[2-[bis(1,4-dicarboxybutyl)amino]ethyl-(1,4-dicarboxybutyl)amino]hexanedioic acid.
| Compound Name | 2-[2-[bis(1,4-dicarboxybutyl)amino]ethyl-(1,4-dicarboxybutyl)amino]hexanedioic acid |
|---|---|
| PubChem CID | 169227887 |
| Molecular Formula | C26H40N2O16 |
| Molecular Weight | 636.60 g/mol |
| Exact Mass | 636.24 |
| IUPAC Name | 2-[2-[bis(1,4-dicarboxybutyl)amino]ethyl-(1,4-dicarboxybutyl)amino]hexanedioic acid |
| SMILES | O=C(O)CCCC(C(=O)O)N(CCN(C(CCCC(=O)O)C(=O)O)C(CCCC(=O)O)C(=O)O)C(CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H40N2O16/c29-19(30)9-1-5-15(23(37)38)27(16(24(39)40)6-2-10-20(31)32)13-14-28(17(25(41)42)7-3-11-21(33)34)18(26(43)44)8-4-12-22(35)36/h15-18H,1-14H2,(H,29,30)(H,31,32)(H,33,34)(H,35,36)(H,37,38)(H,39,40)(H,41,42)(H,43,44) |
| InChIKey | WJRZFVKOKABORY-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 304.88 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.60 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |