2-isocyanohexanedioic acid

C7H9NO4 — CID 70674090

IUPAC2-isocyanohexanedioic acid
SMILES[C-]#[N+]C(CCCC(=O)O)C(=O)O
InChIInChI=1S/C7H9NO4/c1-8-5(7(11)12)3-2-4-6(9)10/h5H,2-4H2,(H,9,10)(H,11,12)
InChIKeyRNTUIUOQHSTLCE-UHFFFAOYSA-N
MW171.15 g/mol
LogP0.61
Rot. Bonds5

About 2-isocyanohexanedioic acid

2-isocyanohexanedioic acid (PubChem CID 70674090) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is 2-isocyanohexanedioic acid.

Molecular Properties

Compound Name2-isocyanohexanedioic acid
PubChem CID70674090
Molecular FormulaC7H9NO4
Molecular Weight171.15 g/mol
Exact Mass171.05
IUPAC Name2-isocyanohexanedioic acid
SMILES[C-]#[N+]C(CCCC(=O)O)C(=O)O
InChIInChI=1S/C7H9NO4/c1-8-5(7(11)12)3-2-4-6(9)10/h5H,2-4H2,(H,9,10)(H,11,12)
InChIKeyRNTUIUOQHSTLCE-UHFFFAOYSA-N
XLogP0.61
TPSA78.96 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500171.15
LogP ≤ 50.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}

Analyze 2-isocyanohexanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-isocyanohexanedioic acid?
The IUPAC name of 2-isocyanohexanedioic acid (CID 70674090) is 2-isocyanohexanedioic acid.
What is the SMILES notation for 2-isocyanohexanedioic acid?
The canonical SMILES for 2-isocyanohexanedioic acid is [C-]#[N+]C(CCCC(=O)O)C(=O)O.
What is the InChIKey of 2-isocyanohexanedioic acid?
The InChIKey is RNTUIUOQHSTLCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4/c1-8-5(7(11)12)3-2-4-6(9)10/h5H,2-4H2,(H,9,10)(H,11,12).
What are the key properties of 2-isocyanohexanedioic acid?
2-isocyanohexanedioic acid has a molecular weight of 171.15 g/mol, XLogP of 0.61, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanohexanedioic acid is sourced from PubChem (CID 70674090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).