About 5-isocyanopentanoic acid
5-isocyanopentanoic acid (PubChem CID 21280306) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 5-isocyanopentanoic acid.
Molecular Properties
| Compound Name | 5-isocyanopentanoic acid |
| PubChem CID | 21280306 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 5-isocyanopentanoic acid |
| SMILES | [C-]#[N+]CCCCC(=O)O |
| InChI | InChI=1S/C6H9NO2/c1-7-5-3-2-4-6(8)9/h2-5H2,(H,8,9) |
| InChIKey | SXTQZFBMJOQGEE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 41.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyanopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyanopentanoic acid?
The IUPAC name of 5-isocyanopentanoic acid (CID 21280306) is 5-isocyanopentanoic acid.
What is the SMILES notation for 5-isocyanopentanoic acid?
The canonical SMILES for 5-isocyanopentanoic acid is [C-]#[N+]CCCCC(=O)O.
What is the InChIKey of 5-isocyanopentanoic acid?
The InChIKey is SXTQZFBMJOQGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-7-5-3-2-4-6(8)9/h2-5H2,(H,8,9).
What are the key properties of 5-isocyanopentanoic acid?
5-isocyanopentanoic acid has a molecular weight of 127.14 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyanopentanoic acid is sourced from PubChem (CID 21280306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).