5-isocyanopentanoic acid

C6H9NO2 — CID 21280306

IUPAC5-isocyanopentanoic acid
SMILES[C-]#[N+]CCCCC(=O)O
InChIInChI=1S/C6H9NO2/c1-7-5-3-2-4-6(8)9/h2-5H2,(H,8,9)
InChIKeySXTQZFBMJOQGEE-UHFFFAOYSA-N
MW127.14 g/mol
LogP1.16
Rot. Bonds4

About 5-isocyanopentanoic acid

5-isocyanopentanoic acid (PubChem CID 21280306) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 5-isocyanopentanoic acid.

Molecular Properties

Compound Name5-isocyanopentanoic acid
PubChem CID21280306
Molecular FormulaC6H9NO2
Molecular Weight127.14 g/mol
Exact Mass127.06
IUPAC Name5-isocyanopentanoic acid
SMILES[C-]#[N+]CCCCC(=O)O
InChIInChI=1S/C6H9NO2/c1-7-5-3-2-4-6(8)9/h2-5H2,(H,8,9)
InChIKeySXTQZFBMJOQGEE-UHFFFAOYSA-N
XLogP1.16
TPSA41.66 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500127.14
LogP ≤ 51.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}

Analyze 5-isocyanopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-isocyanopentanoic acid?
The IUPAC name of 5-isocyanopentanoic acid (CID 21280306) is 5-isocyanopentanoic acid.
What is the SMILES notation for 5-isocyanopentanoic acid?
The canonical SMILES for 5-isocyanopentanoic acid is [C-]#[N+]CCCCC(=O)O.
What is the InChIKey of 5-isocyanopentanoic acid?
The InChIKey is SXTQZFBMJOQGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2/c1-7-5-3-2-4-6(8)9/h2-5H2,(H,8,9).
What are the key properties of 5-isocyanopentanoic acid?
5-isocyanopentanoic acid has a molecular weight of 127.14 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyanopentanoic acid is sourced from PubChem (CID 21280306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).