About 2-isocyanohexanoic acid
2-isocyanohexanoic acid (PubChem CID 20568078) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-isocyanohexanoic acid.
Molecular Properties
| Compound Name | 2-isocyanohexanoic acid |
| PubChem CID | 20568078 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 2-isocyanohexanoic acid |
| SMILES | [C-]#[N+]C(CCCC)C(=O)O |
| InChI | InChI=1S/C7H11NO2/c1-3-4-5-6(8-2)7(9)10/h6H,3-5H2,1H3,(H,9,10) |
| InChIKey | IOUOVGMFIBMQHL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanohexanoic acid?
The IUPAC name of 2-isocyanohexanoic acid (CID 20568078) is 2-isocyanohexanoic acid.
What is the SMILES notation for 2-isocyanohexanoic acid?
The canonical SMILES for 2-isocyanohexanoic acid is [C-]#[N+]C(CCCC)C(=O)O.
What is the InChIKey of 2-isocyanohexanoic acid?
The InChIKey is IOUOVGMFIBMQHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-3-4-5-6(8-2)7(9)10/h6H,3-5H2,1H3,(H,9,10).
What are the key properties of 2-isocyanohexanoic acid?
2-isocyanohexanoic acid has a molecular weight of 141.17 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanohexanoic acid is sourced from PubChem (CID 20568078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).