C14H16FN3S — CID 82332151
1-(5-fluoro-1-prop-2-ynylbenzimidazol-2-yl)-3-methylsulfanylpropan-1-amine (PubChem CID 82332151) has the molecular formula C14H16FN3S and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-(5-fluoro-1-prop-2-ynylbenzimidazol-2-yl)-3-methylsulfanylpropan-1-amine.
| Compound Name | 1-(5-fluoro-1-prop-2-ynylbenzimidazol-2-yl)-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 82332151 |
| Molecular Formula | C14H16FN3S |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-(5-fluoro-1-prop-2-ynylbenzimidazol-2-yl)-3-methylsulfanylpropan-1-amine |
| SMILES | C#CCn1c(C(N)CCSC)nc2cc(F)ccc21 |
| InChI | InChI=1S/C14H16FN3S/c1-3-7-18-13-5-4-10(15)9-12(13)17-14(18)11(16)6-8-19-2/h1,4-5,9,11H,6-8,16H2,2H3 |
| InChIKey | MPUCARHMWPZOKK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|