C19H29N3 — CID 82333331
1-hexyl-5-methyl-2-piperidin-3-ylbenzimidazole (PubChem CID 82333331) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-hexyl-5-methyl-2-piperidin-3-ylbenzimidazole.
| Compound Name | 1-hexyl-5-methyl-2-piperidin-3-ylbenzimidazole |
|---|---|
| PubChem CID | 82333331 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 1-hexyl-5-methyl-2-piperidin-3-ylbenzimidazole |
| SMILES | CCCCCCn1c(C2CCCNC2)nc2cc(C)ccc21 |
| InChI | InChI=1S/C19H29N3/c1-3-4-5-6-12-22-18-10-9-15(2)13-17(18)21-19(22)16-8-7-11-20-14-16/h9-10,13,16,20H,3-8,11-12,14H2,1-2H3 |
| InChIKey | KYQHJDKJZQXPPF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|