C19H27N3 — CID 82334213
1-(2-methylprop-2-enyl)-2-piperidin-3-yl-5-propan-2-ylbenzimidazole (PubChem CID 82334213) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-2-piperidin-3-yl-5-propan-2-ylbenzimidazole.
| Compound Name | 1-(2-methylprop-2-enyl)-2-piperidin-3-yl-5-propan-2-ylbenzimidazole |
|---|---|
| PubChem CID | 82334213 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-2-piperidin-3-yl-5-propan-2-ylbenzimidazole |
| SMILES | C=C(C)Cn1c(C2CCCNC2)nc2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C19H27N3/c1-13(2)12-22-18-8-7-15(14(3)4)10-17(18)21-19(22)16-6-5-9-20-11-16/h7-8,10,14,16,20H,1,5-6,9,11-12H2,2-4H3 |
| InChIKey | DDUGAPOGQXKPFE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|