C10H6FN3O — CID 82337329
6-fluoro-2-(furan-2-yl)-1H-imidazo[4,5-b]pyridine (PubChem CID 82337329) has the molecular formula C10H6FN3O and a molecular weight of 203.18 g/mol. Its IUPAC name is 6-fluoro-2-(furan-2-yl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 6-fluoro-2-(furan-2-yl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 82337329 |
| Molecular Formula | C10H6FN3O |
| Molecular Weight | 203.18 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 6-fluoro-2-(furan-2-yl)-1H-imidazo[4,5-b]pyridine |
| SMILES | Fc1cnc2nc(-c3ccco3)[nH]c2c1 |
| InChI | InChI=1S/C10H6FN3O/c11-6-4-7-9(12-5-6)14-10(13-7)8-2-1-3-15-8/h1-5H,(H,12,13,14) |
| InChIKey | PYJVESKGPGVHCO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |