C14H13N3O — CID 82337467
2-(3,4-dimethylphenyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine (PubChem CID 82337467) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine.
| Compound Name | 2-(3,4-dimethylphenyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine |
|---|---|
| PubChem CID | 82337467 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-[1,3]oxazolo[4,5-b]pyridin-6-amine |
| SMILES | Cc1ccc(-c2nc3ncc(N)cc3o2)cc1C |
| InChI | InChI=1S/C14H13N3O/c1-8-3-4-10(5-9(8)2)14-17-13-12(18-14)6-11(15)7-16-13/h3-7H,15H2,1-2H3 |
| InChIKey | LDPVHWJQRCUJMN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |