C13H17NO6 — CID 82344855
2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid (PubChem CID 82344855) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid.
| Compound Name | 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 82344855 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid |
| SMILES | COc1ccc(C(NC(C)C(=O)O)C(=O)O)cc1OC |
| InChI | InChI=1S/C13H17NO6/c1-7(12(15)16)14-11(13(17)18)8-4-5-9(19-2)10(6-8)20-3/h4-7,11,14H,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | NMMPDLDUJPCGHX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |