2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid

C13H17NO6 — CID 82344855

IUPAC2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid
SMILESCOc1ccc(C(NC(C)C(=O)O)C(=O)O)cc1OC
InChIInChI=1S/C13H17NO6/c1-7(12(15)16)14-11(13(17)18)8-4-5-9(19-2)10(6-8)20-3/h4-7,11,14H,1-3H3,(H,15,16)(H,17,18)
InChIKeyNMMPDLDUJPCGHX-UHFFFAOYSA-N
MW283.28 g/mol
LogP0.89
Rot. Bonds7

About 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid

2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid (PubChem CID 82344855) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid.

Molecular Properties

Compound Name2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid
PubChem CID82344855
Molecular FormulaC13H17NO6
Molecular Weight283.28 g/mol
Exact Mass283.11
IUPAC Name2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid
SMILESCOc1ccc(C(NC(C)C(=O)O)C(=O)O)cc1OC
InChIInChI=1S/C13H17NO6/c1-7(12(15)16)14-11(13(17)18)8-4-5-9(19-2)10(6-8)20-3/h4-7,11,14H,1-3H3,(H,15,16)(H,17,18)
InChIKeyNMMPDLDUJPCGHX-UHFFFAOYSA-N
XLogP0.89
TPSA105.09 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.28
LogP ≤ 50.89
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid?
The IUPAC name of 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid (CID 82344855) is 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid.
What is the SMILES notation for 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid?
The canonical SMILES for 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid is COc1ccc(C(NC(C)C(=O)O)C(=O)O)cc1OC.
What is the InChIKey of 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid?
The InChIKey is NMMPDLDUJPCGHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO6/c1-7(12(15)16)14-11(13(17)18)8-4-5-9(19-2)10(6-8)20-3/h4-7,11,14H,1-3H3,(H,15,16)(H,17,18).
What are the key properties of 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid?
2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid has a molecular weight of 283.28 g/mol, XLogP of 0.89, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[carboxy-(3,4-dimethoxyphenyl)methyl]amino]propanoic acid is sourced from PubChem (CID 82344855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).